|
CAS#: 138668-74-3 Product: (E)-2-Phosphonooxybut-2-Enedioic Acid No suppilers available for the product. |
| Name | (E)-2-Phosphonooxybut-2-Enedioic Acid |
|---|---|
| Synonyms | Trisodium Carboxyphosphoenolpyruvate; ((1-Carboxyethenyl)Oxy)Hydroxyphosphinecarboxylic Acid Oxide; Cpepa |
| Molecular Structure | ![]() |
| Molecular Formula | C4H5O8P |
| Molecular Weight | 212.05 |
| CAS Registry Number | 138668-74-3 |
| SMILES | O=[P](OC(/C(=O)O)=C/C(=O)O)(O)O |
| InChI | 1S/C4H5O8P/c5-3(6)1-2(4(7)8)12-13(9,10)11/h1H,(H,5,6)(H,7,8)(H2,9,10,11)/b2-1+ |
| InChIKey | KMNAUSZAPXSXLU-OWOJBTEDSA-N |
| Density | 2.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.272°C at 760 mmHg (Cal.) |
| Flash point | 287.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-2-Phosphonooxybut-2-Enedioic Acid |