|
CAS#: 13893-97-5 Product: 5-Methyl-1-Phenylhexane-1,3-Dione No suppilers available for the product. |
| Name | 5-Methyl-1-Phenylhexane-1,3-Dione |
|---|---|
| Synonyms | 5-Methyl-1-Phenyl-Hexane-1,3-Dione; 1-Fenil-5-Metilesan-1,3-Dione [Italian] |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 13893-97-5 |
| EINECS | 237-661-1 |
| SMILES | C1=C(C(=O)CC(=O)CC(C)C)C=CC=C1 |
| InChI | 1S/C13H16O2/c1-10(2)8-12(14)9-13(15)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | XVTWRQCEQFDSBK-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.763°C at 760 mmHg (Cal.) |
| Flash point | 113.905°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-1-Phenylhexane-1,3-Dione |