|
CAS#: 139-68-4 Product: Phenatine No suppilers available for the product. |
| Name | Phenatine |
|---|---|
| Synonyms | N-(1-Methyl-2-Phenyl-Ethyl)Pyridine-3-Carboxamide; N-(1-Methyl-2-Phenylethyl)-3-Pyridinecarboxamide; N-(1-Methyl-2-Phenyl-Ethyl)Nicotinamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30 |
| CAS Registry Number | 139-68-4 |
| SMILES | C2=C(CC(NC(C1=CN=CC=C1)=O)C)C=CC=C2 |
| InChI | 1S/C15H16N2O/c1-12(10-13-6-3-2-4-7-13)17-15(18)14-8-5-9-16-11-14/h2-9,11-12H,10H2,1H3,(H,17,18) |
| InChIKey | KJRJJAZBUWXZFN-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.9±28.0°C at 760 mmHg (Cal.) |
| Flash point | 235.6±24.0°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenatine |