Online Database of Chemicals from Around the World
|
CAS#: 13901-82-1 Product: Dimethyl 2,5-Dimethyl-1-Phenyl-Pyrrole-3,4-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 2,5-Dimethyl-1-Phenyl-Pyrrole-3,4-Dicarboxylate |
|---|---|
| Synonyms | Dimethyl 2,5-Dimethyl-1-Phenyl-Pyrrole-3,4-Dicarboxylate; 2,5-Dimethyl-1-Phenylpyrrole-3,4-Dicarboxylic Acid Dimethyl Ester; 2,5-Dimethyl-1-Phenyl-Pyrrole-3,4-Dicarboxylic Acid Dimethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 |
| CAS Registry Number | 13901-82-1 |
| SMILES | C1=CC=CC=C1[N]2C(=C(C(=C2C)C(=O)OC)C(=O)OC)C |
| InChI | 1S/C16H17NO4/c1-10-13(15(18)20-3)14(16(19)21-4)11(2)17(10)12-8-6-5-7-9-12/h5-9H,1-4H3 |
| InChIKey | CTZRWCSFBRGFNT-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.242°C at 760 mmHg (Cal.) |
| Flash point | 186.183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 2,5-Dimethyl-1-Phenyl-Pyrrole-3,4-Dicarboxylate |