|
CAS#: 139395-96-3 Product: 4-[4-(4-Ethylcyclohexyl)Cyclohexyl]-2-Fluoro-1-(Trifluoromethoxy)Benzene No suppilers available for the product. |
| Name | 4-[4-(4-Ethylcyclohexyl)Cyclohexyl]-2-Fluoro-1-(Trifluoromethoxy)Benzene |
|---|---|
| Synonyms | Benzene, |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28F4O |
| Molecular Weight | 372.44 |
| CAS Registry Number | 139395-96-3 |
| SMILES | FC(F)(F)Oc1ccc(cc1F)C2CCC(CC2)C3CCC(CC3)CC |
| InChI | 1S/C21H28F4O/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-12-20(19(22)13-18)26-21(23,24)25/h11-17H,2-10H2,1H3 |
| InChIKey | FTPVGOBGOGGSPI-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.623°C at 760 mmHg (Cal.) |
| Flash point | 175.317°C (Cal.) |
| Refractive index | 1.478 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[4-(4-Ethylcyclohexyl)Cyclohexyl]-2-Fluoro-1-(Trifluoromethoxy)Benzene |