|
CAS#: 13950-57-7 Product: Ethyl (Diphenylmethylsilyl)Acetate No suppilers available for the product. |
| Name | Ethyl (Diphenylmethylsilyl)Acetate |
|---|---|
| Synonyms | 2-(Methyl-Di(Phenyl)Silyl)Acetic Acid Ethyl Ester; Ethyl 2-(Methyl-Di(Phenyl)Silyl)Ethanoate; Nsc108055 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20O2Si |
| Molecular Weight | 284.43 |
| CAS Registry Number | 13950-57-7 |
| SMILES | C2=C([Si](C1=CC=CC=C1)(CC(OCC)=O)C)C=CC=C2 |
| InChI | 1S/C17H20O2Si/c1-3-19-17(18)14-20(2,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,3,14H2,1-2H3 |
| InChIKey | MFIAJOGCRUYZQO-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.443°C at 760 mmHg (Cal.) |
| Flash point | 142.833°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (Diphenylmethylsilyl)Acetate |