| MolMall | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (21) 802-1834 | |||
![]() |
info@molmall.net | |||
| Chemical manufacturer since 2012 | ||||
| Sinova Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (301) 961-1525 | |||
![]() |
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | (2E)-6-Bromo-2-(3-Oxo-1,3-Dihydro-2H-Indol-2-Ylidene)-1,2-Dihydro-3H-Indol-3-One |
|---|---|
| Synonyms | 6-Monobromoindigo; ZINC04293427 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9BrN2O2 |
| Molecular Weight | 341.16 |
| CAS Registry Number | 139582-54-0 |
| SMILES | C1=CC=C2C(=C1)C(=O)/C(=C\3/C(=O)C4=C(N3)C=C(C=C4)Br)/N2 |
| InChI | 1S/C16H9BrN2O2/c17-8-5-6-10-12(7-8)19-14(16(10)21)13-15(20)9-3-1-2-4-11(9)18-13/h1-7,18-19H/b14-13+ |
| InChIKey | PMUIAXBFQHYSSX-BUHFOSPRSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 222.5±28.7°C (Cal.) |
| Refractive index | 1.725 (Cal.) |
| (1) | López Chávez Felipe Javier, Chávez Patricia Ríos, Oyama Ken. Brominated precursors of Tyrian purple (C.I. Natural Violet 1) from Plicopurpura pansa, Plicopurpura columellaris and Plicopurpura patula, Dyes and Pigments, 2009 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2E)-6-Bromo-2-(3-Oxo-1,3-Dihydro-2H-Indol-2-Ylidene)-1,2-Dihydro-3H-Indol-3-One |