|
CAS#: 13987-45-6 Product: 4,4'-Dihydroxy-3,3'-Biphenyldicarboxylic Acid No suppilers available for the product. |
| Name | 4,4'-Dihydroxy-3,3'-Biphenyldicarboxylic Acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O6 |
| Molecular Weight | 274.23 |
| CAS Registry Number | 13987-45-6 |
| SMILES | O=C(O)c1cc(ccc1O)c2cc(C(=O)O)c(O)cc2 |
| InChI | 1S/C14H10O6/c15-11-3-1-7(5-9(11)13(17)18)8-2-4-12(16)10(6-8)14(19)20/h1-6,15-16H,(H,17,18)(H,19,20) |
| InChIKey | UISWLBIMLGAHMF-UHFFFAOYSA-N |
| Density | 1.553g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.093°C at 760 mmHg (Cal.) |
| Flash point | 298.735°C (Cal.) |
| Refractive index | 1.703 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dihydroxy-3,3'-Biphenyldicarboxylic Acid |