|
CAS#: 13991-81-6 Product: 4,4'-Bis(Dimethylamino)Thiocarbanilide No suppilers available for the product. |
| Name | 4,4'-Bis(Dimethylamino)Thiocarbanilide |
|---|---|
| Synonyms | Aids-019376; 4,4'-Bis(Dimethylamino)Thiocarbanilide; Nsc43953 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.45 |
| CAS Registry Number | 13991-81-6 |
| SMILES | C1=CC(=CC=C1NC(NC2=CC=C(N(C)C)C=C2)=S)N(C)C |
| InChI | 1S/C17H22N4S/c1-20(2)15-9-5-13(6-10-15)18-17(22)19-14-7-11-16(12-8-14)21(3)4/h5-12H,1-4H3,(H2,18,19,22) |
| InChIKey | PZLTXMRUOFZLOW-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.391°C at 760 mmHg (Cal.) |
| Flash point | 234.656°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-Bis(Dimethylamino)Thiocarbanilide |