|
CAS#: 139953-21-2 Product: 2-[(5R,8S,8aR)-8-Methyl-2-Oxo-4,5,6,7,8,8a-Hexahydro-1H-Azulen-5-Yl]Prop-2-Enoic Acid No suppilers available for the product. |
| Name | 2-[(5R,8S,8aR)-8-Methyl-2-Oxo-4,5,6,7,8,8a-Hexahydro-1H-Azulen-5-Yl]Prop-2-Enoic Acid |
|---|---|
| Synonyms | 2-[(5R,8S,8Ar)-2-Keto-8-Methyl-4,5,6,7,8,8A-Hexahydro-1H-Azulen-5-Yl]Acrylic Acid; 5-Azuleneacetic Acid, 1,2,4,5,6,7,8,8A-Octahydro-8-Methyl-Alpha-Methylene-2-Oxo-, (5R-(5Alpha,8Alpha,8Aalpha))- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| CAS Registry Number | 139953-21-2 |
| SMILES | [C@@H]12C(=CC(=O)C1)C[C@@H](CC[C@@H]2C)C(C(=O)O)=C |
| InChI | 1S/C14H18O3/c1-8-3-4-10(9(2)14(16)17)5-11-6-12(15)7-13(8)11/h6,8,10,13H,2-5,7H2,1H3,(H,16,17)/t8-,10+,13+/m0/s1 |
| InChIKey | DQHZYBAJZKMYQB-IYYTYJHQSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.952°C at 760 mmHg (Cal.) |
| Flash point | 234.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(5R,8S,8aR)-8-Methyl-2-Oxo-4,5,6,7,8,8a-Hexahydro-1H-Azulen-5-Yl]Prop-2-Enoic Acid |