|
CAS#: 13997-32-5 Product: 4-Amino-2-Chloro-5-(4-Iodophenoxy)Phenyl Thiocyanate No suppilers available for the product. |
| Name | 4-Amino-2-Chloro-5-(4-Iodophenoxy)Phenyl Thiocyanate |
|---|---|
| Synonyms | 4-Amino-2-chloro-5-(4-iodophenoxy)phenyl thiocyanate # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8ClIN2OS |
| Molecular Weight | 402.64 |
| CAS Registry Number | 13997-32-5 |
| SMILES | Clc2cc(c(Oc1ccc(I)cc1)cc2SC#N)N |
| InChI | 1S/C13H8ClIN2OS/c14-10-5-11(17)12(6-13(10)19-7-16)18-9-3-1-8(15)2-4-9/h1-6H,17H2 |
| InChIKey | SHMXEVFLBSTREN-UHFFFAOYSA-N |
| Density | 1.88g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.77°C at 760 mmHg (Cal.) |
| Flash point | 221.579°C (Cal.) |
| Refractive index | 1.749 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-2-Chloro-5-(4-Iodophenoxy)Phenyl Thiocyanate |