| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 4,6-Dimethyl-2-Benzopyrone |
|---|---|
| Synonyms | 4,6-Dimethyl-2-Chromenone; 4,6-Dimethylcoumarin; 4,6-Dimethyl-2H-Chromen-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 14002-89-2 |
| EINECS | 237-806-9 |
| SMILES | C1=CC(=CC2=C1OC(=O)C=C2C)C |
| InChI | 1S/C11H10O2/c1-7-3-4-10-9(5-7)8(2)6-11(12)13-10/h3-6H,1-2H3 |
| InChIKey | VSSFMDMVOWSDBX-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.323°C at 760 mmHg (Cal.) |
| Flash point | 127.587°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | H.-W. Wang, Y.-Q. Feng, J.-Q. Xue and Z.-Q. Shi. 4,6-Dimethyl-2H-chromen-2-one, Acta Cryst. (2007). E63, o3556 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethyl-2-Benzopyrone |