Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,2'-[1,3-Phenylenebis(Methyleneoxy)]Dibenzaldehyde |
|---|---|
| Synonyms | 1,3-Phenylenbis(methoxy-2-benzaldehyde); 2,2'-[1,3-Phenylenbis(methylenoxy)]dibenzaldehyd |
| Molecular Structure | ![CAS#: 140160-96-9, 2,2'-[1,3-Phenylenebis(Methyleneoxy)]Dibenzaldehyde](/moreStructures/140160-96-9.gif) |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 |
| CAS Registry Number | 140160-96-9 |
| SMILES | c1ccc(c(c1)C=O)OCc2cccc(c2)COc3ccccc3C=O |
| InChI | 1S/C22H18O4/c23-13-19-8-1-3-10-21(19)25-15-17-6-5-7-18(12-17)16-26-22-11-4-2-9-20(22)14-24/h1-14H,15-16H2 |
| InChIKey | AASAKDQVGZXIBY-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.3±40.0°C at 760 mmHg (Cal.) |
| Flash point | 241.4±27.4°C (Cal.) |
| Refractive index | 1.643 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-[1,3-Phenylenebis(Methyleneoxy)]Dibenzaldehyde |