|
CAS#: 14053-16-8 Product: 1-(4-Acetyloxyphenyl)-2-Pyrrolidone No suppilers available for the product. |
| Name | 1-(4-Acetyloxyphenyl)-2-Pyrrolidone |
|---|---|
| Synonyms | Acetic Acid [4-(2-Oxo-1-Pyrrolidinyl)Phenyl] Ester; Acetic Acid [4-(2-Ketopyrrolidin-1-Yl)Phenyl] Ester; [4-(2-Oxopyrrolidin-1-Yl)Phenyl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 |
| CAS Registry Number | 14053-16-8 |
| SMILES | C1=CC(=CC=C1N2C(CCC2)=O)OC(=O)C |
| InChI | 1S/C12H13NO3/c1-9(14)16-11-6-4-10(5-7-11)13-8-2-3-12(13)15/h4-7H,2-3,8H2,1H3 |
| InChIKey | FPQOGNXITGCHBL-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.937°C at 760 mmHg (Cal.) |
| Flash point | 221.076°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Acetyloxyphenyl)-2-Pyrrolidone |