|
CAS#: 14064-41-6 Product: 1-Methoxy-3-[(E)-2-Phenylvinyl]Benzene No suppilers available for the product. |
| Name | 1-Methoxy-3-[(E)-2-Phenylvinyl]Benzene |
|---|---|
| Synonyms | 1-Methoxy-3-(2-phenylethenyl)benzene; 1-Methoxy-3-[(E)-2-phenylethenyl]benzene #; m-Methoxystilbene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.27 |
| CAS Registry Number | 14064-41-6 |
| SMILES | O(c2cc(\C=C\c1ccccc1)ccc2)C |
| InChI | 1S/C15H14O/c1-16-15-9-5-8-14(12-15)11-10-13-6-3-2-4-7-13/h2-12H,1H3/b11-10+ |
| InChIKey | LZINUFCUTQOYOO-ZHACJKMWSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.903°C at 760 mmHg (Cal.) |
| Flash point | 131.042°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-3-[(E)-2-Phenylvinyl]Benzene |