| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | (E)-1-Phenyl-2-M-Tolylethene |
|---|---|
| Synonyms | 1-Methyl-3-(2-Phenylethenyl)Benzene; 1-Methyl-3-[(E)-2-Phenylvinyl]Benzene; 1-Methyl-3-(2-Phenylvinyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 |
| CAS Registry Number | 14064-48-3 |
| SMILES | C1=CC=C(C=C1)\C=C\C2=CC(=CC=C2)C |
| InChI | 1S/C15H14/c1-13-6-5-9-15(12-13)11-10-14-7-3-2-4-8-14/h2-12H,1H3/b11-10+ |
| InChIKey | BRFDXZHUQCOPKE-ZHACJKMWSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.436°C at 760 mmHg (Cal.) |
| Flash point | 142.252°C (Cal.) |
| (1) | L. Gao, H. Peng and H.-W. He. (E)-3-Methylstilbene, Acta Cryst. (2006). E62, o5032-o5033 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (E)-1-Phenyl-2-M-Tolylethene |