|
CAS#: 14070-15-6 Product: 2-(Dimethylamino)-4,5-Diphenyloxazole No suppilers available for the product. |
| Name | 2-(Dimethylamino)-4,5-Diphenyloxazole |
|---|---|
| Synonyms | N,N-Dimethyl-4,5-Di(Phenyl)Oxazol-2-Amine; N,N-Dimethyl-4,5-Di(Phenyl)-2-Oxazolamine; [4,5-Di(Phenyl)Oxazol-2-Yl]-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 |
| CAS Registry Number | 14070-15-6 |
| SMILES | C1=CC=CC=C1C2=C(N=C(O2)N(C)C)C3=CC=CC=C3 |
| InChI | 1S/C17H16N2O/c1-19(2)17-18-15(13-9-5-3-6-10-13)16(20-17)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | PLGBHXSQSNOWAZ-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.287°C at 760 mmHg (Cal.) |
| Flash point | 181.372°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)-4,5-Diphenyloxazole |