|
CAS#: 14091-10-2 Product: 2-Acetamido-3-(3,4-Dichlorophenyl)Acrylic Acid No suppilers available for the product. |
| Name | 2-Acetamido-3-(3,4-Dichlorophenyl)Acrylic Acid |
|---|---|
| Synonyms | Maybridge4_004628 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 |
| CAS Registry Number | 14091-10-2 |
| SMILES | Clc1ccc(C=C(C(=O)O)NC(=O)C)cc1Cl |
| InChI | 1S/C11H9Cl2NO3/c1-6(15)14-10(11(16)17)5-7-2-3-8(12)9(13)4-7/h2-5H,1H3,(H,14,15)(H,16,17) |
| InChIKey | HSYXRTFLJZJGAM-UHFFFAOYSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.609°C at 760 mmHg (Cal.) |
| Flash point | 271.074°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetamido-3-(3,4-Dichlorophenyl)Acrylic Acid |