|
CAS#: 14091-93-1 Product: 1-Phenyl-3-(Methylamino)-2-Butene-1-One No suppilers available for the product. |
| Name | 1-Phenyl-3-(Methylamino)-2-Butene-1-One |
|---|---|
| Synonyms | (E)-3-Methylamino-1-Phenyl-But-2-En-1-One; 2-Buten-1-One, 3-(Methylamino)-1-Phenyl-; Crotonophenone, 3-(Methylamino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 |
| CAS Registry Number | 14091-93-1 |
| SMILES | C1=C(C(\C=C(NC)/C)=O)C=CC=C1 |
| InChI | 1S/C11H13NO/c1-9(12-2)8-11(13)10-6-4-3-5-7-10/h3-8,12H,1-2H3/b9-8+ |
| InChIKey | AYAHPVFYLSWGGO-CMDGGOBGSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.2°C at 760 mmHg (Cal.) |
| Flash point | 112.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-3-(Methylamino)-2-Butene-1-One |