Online Database of Chemicals from Around the World
|
CAS#: 14094-48-5 Product: 6,7-Dichloro-4-Nitroquinoline-1-Oxide No suppilers available for the product. |
| Name | 6,7-Dichloro-4-Nitroquinoline-1-Oxide |
|---|---|
| Synonyms | 6,7-Dichloro-4-Nitro-1-Oxido-Quinolin-1-Ium; 6,7-Dichloro-4-Nitroquinoline 1-Oxide; Brn 1250794 |
| Molecular Structure |  |
| Molecular Formula | C9H4Cl2N2O3 |
| Molecular Weight | 259.05 |
| CAS Registry Number | 14094-48-5 |
| SMILES | C1=C(C(=CC2=C([N+]([O-])=O)C=C[N+](=C12)[O-])Cl)Cl |
| InChI | 1S/C9H4Cl2N2O3/c10-6-3-5-8(13(15)16)1-2-12(14)9(5)4-7(6)11/h1-4H |
| InChIKey | WZVIPJLTTWVLHT-UHFFFAOYSA-N |
| Density | 1.698g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.242°C at 760 mmHg (Cal.) |
| Flash point | 226.703°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dichloro-4-Nitroquinoline-1-Oxide |