|
CAS#: 141102-74-1 Product: 2-(Dimethylamino-Fluorophosphoryl)Oxy-N,N-Dimethylethanamine No suppilers available for the product. |
| Name | 2-(Dimethylamino-Fluorophosphoryl)Oxy-N,N-Dimethylethanamine |
|---|---|
| Synonyms | 2-(Dimethylamino-Fluoro-Phosphoryl)Oxy-N,N-Dimethyl-Ethanamine; 2-(Dimethylamino-Fluoro-Phosphoryl)Oxyethyl-Dimethyl-Amine; Gv Substance |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16FN2O2P |
| Molecular Weight | 198.18 |
| CAS Registry Number | 141102-74-1 |
| SMILES | C(O[P](F)(=O)N(C)C)CN(C)C |
| InChI | 1S/C6H16FN2O2P/c1-8(2)5-6-11-12(7,10)9(3)4/h5-6H2,1-4H3 |
| InChIKey | SQOVUABAJBECMK-UHFFFAOYSA-N |
| Density | 1.113g/cm3 (Cal.) |
|---|---|
| Boiling point | 213.629°C at 760 mmHg (Cal.) |
| Flash point | 83°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino-Fluorophosphoryl)Oxy-N,N-Dimethylethanamine |