|
CAS#: 14128-61-1 Product: 5-Methyl-5-Phenyl-2-Hexanone No suppilers available for the product. |
| Name | 5-Methyl-5-Phenyl-2-Hexanone |
|---|---|
| Synonyms | 5-Methyl-5-Phenyl-Hexan-2-One; 5-Methyl-5-Phenyl-2-Hexanone; 2-Hexanone, 5-Methyl-5-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 14128-61-1 |
| SMILES | C1=CC=C(C=C1)C(C)(C)CCC(=O)C |
| InChI | 1S/C13H18O/c1-11(14)9-10-13(2,3)12-7-5-4-6-8-12/h4-8H,9-10H2,1-3H3 |
| InChIKey | IFKGKEYWZPTXEY-UHFFFAOYSA-N |
| Density | 0.938g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.132°C at 760 mmHg (Cal.) |
| Flash point | 113.823°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-5-Phenyl-2-Hexanone |