|
CAS#: 14148-99-3 Product: Lefetamine Hydrochloride No suppilers available for the product. |
| Name | Lefetamine Hydrochloride |
|---|---|
| Synonyms | 1,2-Diphenylethyl-Dimethyl-Ammonium Chloride; 1,2-Diphenylethyl-Dimethylammonium Chloride; 1,2-Diphenylethyl-Dimethyl-Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.79 |
| CAS Registry Number | 14148-99-3 |
| SMILES | C2=C(C(CC1=CC=CC=C1)[NH+](C)C)C=CC=C2.[Cl-] |
| InChI | 1S/C16H19N.ClH/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14;/h3-12,16H,13H2,1-2H3;1H |
| InChIKey | VKIHKZMKDNVEIK-UHFFFAOYSA-N |
| Boiling point | 295.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lefetamine Hydrochloride |