Online Database of Chemicals from Around the World
|
CAS#: 14160-38-4 Product: 3,3'-Di-Tert-Butylbiphenyldiquinone-(2,5,2',5') No suppilers available for the product. |
| Name | 3,3'-Di-Tert-Butylbiphenyldiquinone-(2,5,2',5') |
|---|---|
| Synonyms | 2-Tert-Butyl-6-(5-Tert-Butyl-3,6-Dioxo-1-Cyclohexa-1,4-Dienyl)-1,4-Benzoquinone; 2-Tert-Butyl-6-(5-Tert-Butyl-3,6-Diketo-1-Cyclohexa-1,4-Dienyl)-P-Benzoquinone; (Bi-1,4-Cyclohexadien-1-Yl)-3,3',6,6'-Tetrone, 5,5'-Di-Tert-Butyl- |
| Molecular Structure |  |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 |
| CAS Registry Number | 14160-38-4 |
| SMILES | CC(C2=CC(=O)C=C(C1=CC(=O)C=C(C1=O)C(C)(C)C)C2=O)(C)C |
| InChI | 1S/C20H22O4/c1-19(2,3)15-9-11(21)7-13(17(15)23)14-8-12(22)10-16(18(14)24)20(4,5)6/h7-10H,1-6H3 |
| InChIKey | UONJIDASBODQID-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.98°C at 760 mmHg (Cal.) |
| Flash point | 164.304°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-Di-Tert-Butylbiphenyldiquinone-(2,5,2',5') |