|
CAS#: 14167-74-9 Product: 1,3-Diallyl-5,5-Diethylpyrimidine-2,4,6(1H,3H,5H)-Trione No suppilers available for the product. |
| Name | 1,3-Diallyl-5,5-Diethylpyrimidine-2,4,6(1H,3H,5H)-Trione |
|---|---|
| Synonyms | 1,3-Diallyl-5,5-Diethyl-Hexahydropyrimidine-2,4,6-Trione; 1,3-Diallyl-5,5-Diethylhexahydropyrimidine-2,4,6-Trione; 1,3-Diallyl-5,5-Diethyl-Barbituric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 14167-74-9 |
| SMILES | C(C1(C(N(C(N(C1=O)CC=C)=O)CC=C)=O)CC)C |
| InChI | 1S/C14H20N2O3/c1-5-9-15-11(17)14(7-3,8-4)12(18)16(10-6-2)13(15)19/h5-6H,1-2,7-10H2,3-4H3 |
| InChIKey | OQJNEKQRESAPIR-UHFFFAOYSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.202°C at 760 mmHg (Cal.) |
| Flash point | 129.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diallyl-5,5-Diethylpyrimidine-2,4,6(1H,3H,5H)-Trione |