|
CAS#: 14172-54-4 Product: Thiocystine No suppilers available for the product. |
| Name | Thiocystine |
|---|---|
| Synonyms | (2R)-2-Amino-3-[(2R)-2-Amino-3-Hydroxy-3-Oxo-Propyl]Sulfanyldisulfanyl-Propanoic Acid; (2R)-2-Amino-3-[[(2R)-2-Amino-3-Hydroxy-3-Oxopropyl]Thio]Disulfanylpropanoic Acid; (2R)-2-Amino-3-[[(2R)-2-Amino-3-Hydroxy-3-Keto-Propyl]Thio]Disulfanyl-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N2O4S3 |
| Molecular Weight | 272.35 |
| CAS Registry Number | 14172-54-4 |
| SMILES | [C@H](C(=O)O)(N)CSSSC[C@@H](C(=O)O)N |
| InChI | 1S/C6H12N2O4S3/c7-3(5(9)10)1-13-15-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | LUSVBJKSQBHANR-IMJSIDKUSA-N |
| Density | 1.632g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.264°C at 760 mmHg (Cal.) |
| Flash point | 273.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiocystine |