|
CAS#: 14182-35-5 Product: 5-Nitro-3-Phenyl-1H-Indole No suppilers available for the product. |
| Name | 5-Nitro-3-Phenyl-1H-Indole |
|---|---|
| Synonyms | 5-Nitro-3-phenyl-1H-indole # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 14182-35-5 |
| SMILES | [O-][N+](=O)c1cc2c(cc1)ncc2c3ccccc3 |
| InChI | 1S/C14H10N2O2/c17-16(18)11-6-7-14-12(8-11)13(9-15-14)10-4-2-1-3-5-10/h1-9,15H |
| InChIKey | DCNCQDFYTMGSMZ-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.942°C at 760 mmHg (Cal.) |
| Flash point | 243.456°C (Cal.) |
| Refractive index | 1.706 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-3-Phenyl-1H-Indole |