|
CAS#: 141901-74-8 Product: 3-Hydroxy-2-(2-Phenylphenyl)-3-[4-(Trifluoromethyl)Phenyl]Propanoic Acid No suppilers available for the product. |
| Name | 3-Hydroxy-2-(2-Phenylphenyl)-3-[4-(Trifluoromethyl)Phenyl]Propanoic Acid |
|---|---|
| Synonyms | 3-Hydroxy-2-(2-Phenylphenyl)-3-[4-(Trifluoromethyl)Phenyl]Propionic Acid; 4-Tmbpa; 4-Trifluoromethylphenyl-2-Biphenylyl-3-Hydroxypropionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C22H17F3O3 |
| Molecular Weight | 386.37 |
| CAS Registry Number | 141901-74-8 |
| SMILES | C2=C(C(C(=O)O)C(O)C1=CC=C(C=C1)C(F)(F)F)C(=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C22H17F3O3/c23-22(24,25)16-12-10-15(11-13-16)20(26)19(21(27)28)18-9-5-4-8-17(18)14-6-2-1-3-7-14/h1-13,19-20,26H,(H,27,28) |
| InChIKey | WZCPXDVHGSRSLT-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.563°C at 760 mmHg (Cal.) |
| Flash point | 261.37°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-2-(2-Phenylphenyl)-3-[4-(Trifluoromethyl)Phenyl]Propanoic Acid |