|
CAS#: 141974-84-7 Product: 8-Methoxy-2,3-Dihydro-1H-Pyrrolo[2,1-b]Quinazolin-9-One No suppilers available for the product. |
| Name | 8-Methoxy-2,3-Dihydro-1H-Pyrrolo[2,1-b]Quinazolin-9-One |
|---|---|
| Synonyms | Pyrrolo(2,1-B)Quinazolin-9(1H)-One, 2,3-Dihydromethoxy-; Cdri 73-602; Cdri-73-602 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 141974-84-7 |
| SMILES | C3=C(C1=C(N=C2N(C1=O)CCC2)C=C3)OC |
| InChI | 1S/C12H12N2O2/c1-16-9-5-2-4-8-11(9)12(15)14-7-3-6-10(14)13-8/h2,4-5H,3,6-7H2,1H3 |
| InChIKey | GVVYSUNKTNLDTP-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.272°C at 760 mmHg (Cal.) |
| Flash point | 196.482°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methoxy-2,3-Dihydro-1H-Pyrrolo[2,1-b]Quinazolin-9-One |