|
CAS#: 142001-90-9 Product: N-[(2S)-2-(3,4-Dichlorophenyl)-4-Hydroxybutyl]-N-Methylbenzamide No suppilers available for the product. |
| Name | N-[(2S)-2-(3,4-Dichlorophenyl)-4-Hydroxybutyl]-N-Methylbenzamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 |
| CAS Registry Number | 142001-90-9 |
| SMILES | Clc1ccc(cc1Cl)[C@H](CCO)CN(C)C(=O)c2ccccc2 |
| InChI | 1S/C18H19Cl2NO2/c1-21(18(23)13-5-3-2-4-6-13)12-15(9-10-22)14-7-8-16(19)17(20)11-14/h2-8,11,15,22H,9-10,12H2,1H3/t15-/m1/s1 |
| InChIKey | NOWASWVSADZBSZ-OAHLLOKOSA-N |
| Density | 1.271g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.706°C at 760 mmHg (Cal.) |
| Flash point | 272.342°C (Cal.) |
| Refractive index | 1.596 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2S)-2-(3,4-Dichlorophenyl)-4-Hydroxybutyl]-N-Methylbenzamide |