Online Database of Chemicals from Around the World
|
CAS#: 14201-58-2 Product: 4-(3-Acetyl-4-Methoxyphenyl)Furan-2(5H)-One No suppilers available for the product. |
| Name | 4-(3-Acetyl-4-Methoxyphenyl)Furan-2(5H)-One |
|---|---|
| Synonyms | 4-(3-Acetyl-4-Methoxy-Phenyl)-5H-Furan-2-One; 4-(3-Ethanoyl-4-Methoxy-Phenyl)-5H-Furan-2-One; 4-(3-Acetyl-4-Methoxyphenyl)Furan-2(5H)-One |
| Molecular Structure |  |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 |
| CAS Registry Number | 14201-58-2 |
| EINECS | 238-053-9 |
| SMILES | C2=C(C1=CC(OC1)=O)C=CC(=C2C(=O)C)OC |
| InChI | 1S/C13H12O4/c1-8(14)11-5-9(3-4-12(11)16-2)10-6-13(15)17-7-10/h3-6H,7H2,1-2H3 |
| InChIKey | PTNTZAYEADFZLE-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.641°C at 760 mmHg (Cal.) |
| Flash point | 205.496°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Acetyl-4-Methoxyphenyl)Furan-2(5H)-One |