Online Database of Chemicals from Around the World
|
CAS#: 14206-74-7 Product: 6-Chloro-4-Oxyimino-1-Phenyl-1,2,3,4-Tetrahydroquinoline No suppilers available for the product. |
| Name | 6-Chloro-4-Oxyimino-1-Phenyl-1,2,3,4-Tetrahydroquinoline |
|---|---|
| Synonyms | 4(1H)-Quinolinone, 2,3-Dihydro-6-Chloro-1-Phenyl-, Oxime; 4(1H)-Quinolinone, 6-Chloro-2,3-Dihydro-1-Phenyl, Oxime; 4(1H)-Quinolone, 6-Chloro-2,3-Dihydro-1-Phenyl-, Oxime (8Ci) |
| Molecular Structure |  |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.73 |
| CAS Registry Number | 14206-74-7 |
| SMILES | C1=C(Cl)C=CC2=C1C(=N/O)\CCN2C3=CC=CC=C3 |
| InChI | 1S/C15H13ClN2O/c16-11-6-7-15-13(10-11)14(17-19)8-9-18(15)12-4-2-1-3-5-12/h1-7,10,19H,8-9H2/b17-14- |
| InChIKey | RVDASWLODZFDBZ-VKAVYKQESA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.76°C at 760 mmHg (Cal.) |
| Flash point | 239.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-4-Oxyimino-1-Phenyl-1,2,3,4-Tetrahydroquinoline |