|
CAS#: 142062-08-6 Product: 3-(1-Aminoethyl)-3-Hydroxyestra-1(10),4-Dien-17-One No suppilers available for the product. |
| Name | 3-(1-Aminoethyl)-3-Hydroxyestra-1(10),4-Dien-17-One |
|---|---|
| Synonyms | 3-aminoethylestrone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.45 |
| CAS Registry Number | 142062-08-6 |
| SMILES | CC(N)C/4(O)C\C=C3C(\CC[C@@H]2[C@@H]3CC[C@]1(C)C(=O)CC[C@H]12)=C\4 |
| InChI | 1S/C20H29NO2/c1-12(21)20(23)10-8-14-13(11-20)3-4-16-15(14)7-9-19(2)17(16)5-6-18(19)22/h8,11-12,15-17,23H,3-7,9-10,21H2,1-2H3/t12?,15-,16-,17+,19+,20?/m1/s1 |
| InChIKey | FYVFWMUGDLMTAL-LUMQLTMNSA-N |
| Density | 1.169g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.747°C at 760 mmHg (Cal.) |
| Flash point | 259.062°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(1-Aminoethyl)-3-Hydroxyestra-1(10),4-Dien-17-One |