|
CAS#: 14214-69-8 Product: delta-4,6-Cholestadienol No suppilers available for the product. |
| Name | delta-4,6-Cholestadienol |
|---|---|
| Synonyms | 17-(1,5-Dimethylhexyl)-10,13-Dimethyl-2,3,8,9,11,12,14,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthren-3-Ol; 4,6-Cholestadien-3Beta-Ol; Cholesta-4,6-Dien-3-Ol, (3Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.64 |
| CAS Registry Number | 14214-69-8 |
| EINECS | 238-069-6 |
| SMILES | C(C(C4C3(C(C2C(C1(C(=CC(O)CC1)C=C2)C)CC3)CC4)C)C)CCC(C)C |
| InChI | 1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9-10,17-19,21-25,28H,6-8,11-16H2,1-5H3 |
| InChIKey | KIULDMFHZZHYKZ-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.905°C at 760 mmHg (Cal.) |
| Flash point | 212.053°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for delta-4,6-Cholestadienol |