|
CAS#: 142161-57-7 Product: 2-Methyl-5H-Imidazo[4,5-c]Pyridine 5-Oxide No suppilers available for the product. |
| Name | 2-Methyl-5H-Imidazo[4,5-c]Pyridine 5-Oxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 |
| CAS Registry Number | 142161-57-7 |
| SMILES | CC1=NC2=C[NH+](C=CC2=N1)[O-] |
| InChI | 1S/C7H7N3O/c1-5-8-6-2-3-10(11)4-7(6)9-5/h2-4,10H,1H3 |
| InChIKey | VMPCOPMETIOPCQ-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.205°C at 760 mmHg (Cal.) |
| Flash point | 90.606°C (Cal.) |
| Refractive index | 1.699 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5H-Imidazo[4,5-c]Pyridine 5-Oxide |