| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 5,5,5-Trifluoro-4-(Trifluoromethyl)-3-Penten-2-One |
|---|---|
| Synonyms | 1,1-Di(trifluoromethyl)but-1-en-3-one; 4,4-Bis(t |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4F6O |
| Molecular Weight | 206.09 |
| CAS Registry Number | 1422-36-2 |
| SMILES | FC(F)(F)/C(=C\C(=O)C)C(F)(F)F |
| InChI | 1S/C6H4F6O/c1-3(13)2-4(5(7,8)9)6(10,11)12/h2H,1H3 |
| InChIKey | NXASNTUMEFAWRZ-UHFFFAOYSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| 1.4102 (Expl.) | |
| Boiling point | 68°C (Expl.) |
| 165.863°C at 760 mmHg (Cal.) | |
| Flash point | 59.398°C (Cal.) |
| 59°C (Expl.) | |
| Refractive index | 1.333 (Expl.) |
| 1.328 (Cal.) | |
| Safety Description | R10,R36/37/38 |
|---|---|
| S3/7,S15,S23,S24/25,S36/37/39,S45 | |
| Flammable/Irritant/Keep Cold | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5,5,5-Trifluoro-4-(Trifluoromethyl)-3-Penten-2-One |