|
CAS#: 1423-13-8 Product: Pentafluoronitrosobenzene No suppilers available for the product. |
| Name | Pentafluoronitrosobenzene |
|---|---|
| Synonyms | 1,2,3,4,5-Pentafluoro-6-Nitroso-Benzene; Benzene, Pentafluoronitroso-; Zinc03847087 |
| Molecular Structure | ![]() |
| Molecular Formula | C6F5NO |
| Molecular Weight | 197.06 |
| CAS Registry Number | 1423-13-8 |
| EINECS | 215-832-1 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)N=O)F)F |
| InChI | 1S/C6F5NO/c7-1-2(8)4(10)6(12-13)5(11)3(1)9 |
| InChIKey | OJBLDDIHYSPHIV-UHFFFAOYSA-N |
| Density | 1.682g/cm3 (Cal.) |
|---|---|
| Boiling point | 202.12°C at 760 mmHg (Cal.) |
| Flash point | 61.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentafluoronitrosobenzene |