|
CAS#: 14235-78-0 Product: 4,4'-Methylenedi(1,2-Benzenediol) No suppilers available for the product. |
| Name | 4,4'-Methylenedi(1,2-Benzenediol) |
|---|---|
| Synonyms | 4-(3,4-dihydroxybenzyl)benzene-1,2-diol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 |
| CAS Registry Number | 14235-78-0 |
| SMILES | C1=CC(=C(C=C1CC2=CC(=C(C=C2)O)O)O)O |
| InChI | 1S/C13H12O4/c14-10-3-1-8(6-12(10)16)5-9-2-4-11(15)13(17)7-9/h1-4,6-7,14-17H,5H2 |
| InChIKey | GGOBECRWBXYXEY-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 252.5±23.3°C (Cal.) |
| Refractive index | 1.704 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Methylenedi(1,2-Benzenediol) |