|
CAS#: 142441-49-4 Product: [2-(1,3-Benzothiazol-2-Yl)-1,3-Benzothiazol-6-Yl] Dihydrogen Phosphate No suppilers available for the product. |
| Name | [2-(1,3-Benzothiazol-2-Yl)-1,3-Benzothiazol-6-Yl] Dihydrogen Phosphate |
|---|---|
| Synonyms | Attophos |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9N2O4PS2 |
| Molecular Weight | 364.33 |
| CAS Registry Number | 142441-49-4 |
| SMILES | C2=C1SC(=NC1=CC=C2O[P](=O)(O)O)C3=NC4=C(S3)C=CC=C4 |
| InChI | 1S/C14H9N2O4PS2/c17-21(18,19)20-8-5-6-10-12(7-8)23-14(16-10)13-15-9-3-1-2-4-11(9)22-13/h1-7H,(H2,17,18,19) |
| InChIKey | BTKMJKKKZATLBU-UHFFFAOYSA-N |
| Density | 1.695g/cm3 (Cal.) |
|---|---|
| Boiling point | 639.001°C at 760 mmHg (Cal.) |
| Flash point | 340.256°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-(1,3-Benzothiazol-2-Yl)-1,3-Benzothiazol-6-Yl] Dihydrogen Phosphate |