|
CAS#: 142469-91-8 Product: (-)-1-(3-Fluorophenyl)-2-Pyrrolidinemethanamine Fumarate No suppilers available for the product. |
| Name | (-)-1-(3-Fluorophenyl)-2-Pyrrolidinemethanamine Fumarate |
|---|---|
| Synonyms | But-2-Enedioic Acid; [1-(3-Fluorophenyl)-2-Pyrrolidinyl]Methanamine; But-2-Enedioic Acid; [1-(3-Fluorophenyl)Pyrrolidin-2-Yl]Methylamine; (-)-1-(3-Fluorophenyl)-2-Pyrrolidinemethanamine Fumarate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.32 |
| CAS Registry Number | 142469-91-8 |
| SMILES | C1=C(F)C=CC=C1N2C(CCC2)CN.O=C(O)\C=C\C(=O)O |
| InChI | 1S/C11H15FN2.C4H4O4/c12-9-3-1-4-10(7-9)14-6-2-5-11(14)8-13;5-3(6)1-2-4(7)8/h1,3-4,7,11H,2,5-6,8,13H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XDHNJJZJPNFFSU-WLHGVMLRSA-N |
| Boiling point | 311.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 142.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (-)-1-(3-Fluorophenyl)-2-Pyrrolidinemethanamine Fumarate |