|
CAS#: 14253-18-0 Product: (2Z)-N-Sec-Butyl-3,3,4,4-Tetraphenyl-2-Oxetanimine No suppilers available for the product. |
| Name | (2Z)-N-Sec-Butyl-3,3,4,4-Tetraphenyl-2-Oxetanimine |
|---|---|
| Synonyms | N-[(2Z)-3,3,4,4-Tetraphenyloxetanylidene]-2-butanamine # |
| Molecular Structure | ![]() |
| Molecular Formula | C31H29NO |
| Molecular Weight | 431.57 |
| CAS Registry Number | 14253-18-0 |
| SMILES | N(=C3\OC(c1ccccc1)(c2ccccc2)C3(c4ccccc4)c5ccccc5)\C(C)CC |
| InChI | 1S/C31H29NO/c1-3-24(2)32-29-30(25-16-8-4-9-17-25,26-18-10-5-11-19-26)31(33-29,27-20-12-6-13-21-27)28-22-14-7-15-23-28/h4-24H,3H2,1-2H3/b32-29- |
| InChIKey | AWZBDXQXGYSILP-OVXWJCGASA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.038°C at 760 mmHg (Cal.) |
| Flash point | 187.308°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-N-Sec-Butyl-3,3,4,4-Tetraphenyl-2-Oxetanimine |