|
CAS#: 14300-12-0 Product: 2,4-Dimethylquinoline 1-Oxide No suppilers available for the product. |
| Name | 2,4-Dimethylquinoline 1-Oxide |
|---|---|
| Synonyms | 2,4-Dimethyl-1-Oxido-Quinolin-1-Ium; 2,4-Dimethylquinoline 1-Oxide; Quinoline, 2,4-Dimethyl-, 1-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 |
| CAS Registry Number | 14300-12-0 |
| SMILES | C1=C([N+](=C2C(=C1C)C=CC=C2)[O-])C |
| InChI | 1S/C11H11NO/c1-8-7-9(2)12(13)11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
| InChIKey | KZZPVCLLJFIKNX-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.994°C at 760 mmHg (Cal.) |
| Flash point | 153.375°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethylquinoline 1-Oxide |