|
CAS#: 143034-64-4 Product: Ethyl 3-Oxo-3H,12H-Benzo[h]Pyrano[3,2-c]Chromene-2-Carboxylate No suppilers available for the product. |
| Name | Ethyl 3-Oxo-3H,12H-Benzo[h]Pyrano[3,2-c]Chromene-2-Carboxylate |
|---|---|
| Synonyms | 3-Oxo-3H, |
| Molecular Structure | ![]() |
| Molecular Formula | C19H14O5 |
| Molecular Weight | 322.31 |
| CAS Registry Number | 143034-64-4 |
| SMILES | CCOC(=O)c1cc2c(oc1=O)-c3ccc4ccccc4c3OC2 |
| InChI | 1S/C19H14O5/c1-2-22-18(20)15-9-12-10-23-17-13-6-4-3-5-11(13)7-8-14(17)16(12)24-19(15)21/h3-9H,2,10H2,1H3 |
| InChIKey | CMGHSTGFCCVIIL-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.547°C at 760 mmHg (Cal.) |
| Flash point | 274.808°C (Cal.) |
| Refractive index | 1.669 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-Oxo-3H,12H-Benzo[h]Pyrano[3,2-c]Chromene-2-Carboxylate |