|
CAS#: 14307-03-0 Product: 2-Amino-2-Deoxyglucitol No suppilers available for the product. |
| Name | 2-Amino-2-Deoxyglucitol |
|---|---|
| Synonyms | 2-Amino-2-Deoxy-D-Glucitol; 2-Amino-2-Deoxyglucitol; D-Glucitol, 2-Amino-2-Deoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15NO5 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 14307-03-0 |
| SMILES | [C@H](CO)([C@@H](O)[C@H](O)[C@H](O)CO)N |
| InChI | 1S/C6H15NO5/c7-3(1-8)5(11)6(12)4(10)2-9/h3-6,8-12H,1-2,7H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | FQORWEQXRQVPBZ-SLPGGIOYSA-N |
| Density | 1.506g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.664°C at 760 mmHg (Cal.) |
| Flash point | 274.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-2-Deoxyglucitol |