|
CAS#: 14315-13-0 Product: 2,3-Dihydrobenzo[b]Thiophene 1,1-Dioxide No suppilers available for the product. |
| Name | 2,3-Dihydrobenzo[b]Thiophene 1,1-Dioxide |
|---|---|
| Synonyms | 2,3-Dihydrobenzothiophene 1,1-Dioxide; Inchi=1/C8h8o2s/C9-11(10)6-5-7-3-1-2-4-8(7)11/H1-4H,5-6H; 1-Thiaindan 1,1-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.21 |
| CAS Registry Number | 14315-13-0 |
| SMILES | C1=CC=CC2=C1[S](=O)(=O)CC2 |
| InChI | 1S/C8H8O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-4H,5-6H2 |
| InChIKey | NKPTVQFJWGCELJ-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.627°C at 760 mmHg (Cal.) |
| Flash point | 231.821°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dihydrobenzo[b]Thiophene 1,1-Dioxide |