|
CAS#: 143268-64-8 Product: 3-Methyl-2-Propan-2-Ylidene-1,3-Benzothiazole No suppilers available for the product. |
| Name | 3-Methyl-2-Propan-2-Ylidene-1,3-Benzothiazole |
|---|---|
| Synonyms | 2-Isopropylidene-3-Methyl-1,3-Benzothiazole; Benzothiazoline, 2-Isopropylidene-3-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.29 |
| CAS Registry Number | 143268-64-8 |
| SMILES | C2=C1N(C(SC1=CC=C2)=C(C)C)C |
| InChI | 1S/C11H13NS/c1-8(2)11-12(3)9-6-4-5-7-10(9)13-11/h4-7H,1-3H3 |
| InChIKey | JWIINRRTBOURGR-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.508°C at 760 mmHg (Cal.) |
| Flash point | 121.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-Propan-2-Ylidene-1,3-Benzothiazole |