|
CAS#: 143380-86-3 Product: 4-(3-Methylpiperidin-1-Yl)-1-Thiophen-2-Ylbutan-1-One Hydrochloride No suppilers available for the product. |
| Name | 4-(3-Methylpiperidin-1-Yl)-1-Thiophen-2-Ylbutan-1-One Hydrochloride |
|---|---|
| Synonyms | 4-(3-Methyl-1-Piperidyl)-1-(2-Thienyl)Butan-1-One Hydrochloride; 4-(3-Methyl-1-Piperidinyl)-1-(2-Thienyl)Butan-1-One Hydrochloride; 4-(3-Methylpiperidin-1-Yl)-1-Thiophen-2-Yl-Butan-1-One Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22ClNOS |
| Molecular Weight | 287.85 |
| CAS Registry Number | 143380-86-3 |
| SMILES | [H+].C1=C(SC=C1)C(=O)CCCN2CC(CCC2)C.[Cl-] |
| InChI | 1S/C14H21NOS.ClH/c1-12-5-2-8-15(11-12)9-3-6-13(16)14-7-4-10-17-14;/h4,7,10,12H,2-3,5-6,8-9,11H2,1H3;1H |
| InChIKey | KQQFNXMFPZQZBP-UHFFFAOYSA-N |
| Boiling point | 377.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 182.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Methylpiperidin-1-Yl)-1-Thiophen-2-Ylbutan-1-One Hydrochloride |