|
CAS#: 1434-85-1 Product: 5-Dihydro-19-Nortestosterone No suppilers available for the product. |
| Name | 5-Dihydro-19-Nortestosterone |
|---|---|
| Synonyms | 5-Dihydro-19-Nortestosterone; 5-Dihydronandrolone; Estran-3-One, 17-Hydroxy-, (5Alpha,17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 |
| CAS Registry Number | 1434-85-1 |
| SMILES | [C@H]12CC(=O)CC[C@@H]1[C@@H]4[C@@H](CC2)[C@@H]3CC[C@@H]([C@@]3(C)CC4)O |
| InChI | 1S/C18H28O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h11,13-17,20H,2-10H2,1H3/t11-,13-,14+,15+,16-,17-,18-/m0/s1 |
| InChIKey | RHVBIEJVJWNXBU-PNOKGRBDSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.874°C at 760 mmHg (Cal.) |
| Flash point | 176.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Dihydro-19-Nortestosterone |