|
CAS#: 143563-42-2 Product: 2-(4-Methyl-1-Cyclohex-3-Enyl)Propan-2-Yl Phosphono Hydrogen Phosphate No suppilers available for the product. |
| Name | 2-(4-Methyl-1-Cyclohex-3-Enyl)Propan-2-Yl Phosphono Hydrogen Phosphate |
|---|---|
| Synonyms | [1-Methyl-1-(4-Methyl-1-Cyclohex-3-Enyl)Ethyl] Phosphono Hydrogen Phosphate; Atopp; Alpha-Terpinyl Pyrophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20O7P2 |
| Molecular Weight | 314.21 |
| CAS Registry Number | 143563-42-2 |
| SMILES | CC(O[P](O[P](=O)(O)O)(=O)O)(C1CC=C(CC1)C)C |
| InChI | 1S/C10H20O7P2/c1-8-4-6-9(7-5-8)10(2,3)16-19(14,15)17-18(11,12)13/h4,9H,5-7H2,1-3H3,(H,14,15)(H2,11,12,13) |
| InChIKey | VPIGSRIRALQQKD-UHFFFAOYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.154°C at 760 mmHg (Cal.) |
| Flash point | 236.931°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methyl-1-Cyclohex-3-Enyl)Propan-2-Yl Phosphono Hydrogen Phosphate |