|
CAS#: 14381-79-4 Product: 1,2-Dibromo-9,10-Anthraquinone No suppilers available for the product. |
| Name | 1,2-Dibromo-9,10-Anthraquinone |
|---|---|
| Synonyms | AIDS017902; AIDS-017902 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H6Br2O2 |
| Molecular Weight | 366.00 |
| CAS Registry Number | 14381-79-4 |
| SMILES | O=C2c1ccccc1C(=O)c3c2ccc(Br)c3Br |
| InChI | 1S/C14H6Br2O2/c15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6H |
| InChIKey | TXWUOIRCWNCWPU-UHFFFAOYSA-N |
| Density | 1.912g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.797°C at 760 mmHg (Cal.) |
| Flash point | 172.19°C (Cal.) |
| Refractive index | 1.701 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dibromo-9,10-Anthraquinone |